|
CAS#: 158573-58-1 Product: Bis(Pentafluorophenyl) 2,2'-Oxydiacetate No suppilers available for the product. |
| Name | Bis(Pentafluorophenyl) 2,2'-Oxydiacetate |
|---|---|
| Synonyms | DIG(Pfp)2 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H4F10O5 |
| Molecular Weight | 466.18 |
| CAS Registry Number | 158573-58-1 |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)COCC(=O)Oc2c(F)c(F)c(F)c(F)c2F |
| InChI | 1S/C16H4F10O5/c17-5-7(19)11(23)15(12(24)8(5)20)30-3(27)1-29-2-4(28)31-16-13(25)9(21)6(18)10(22)14(16)26/h1-2H2 |
| InChIKey | VNIBHSPJYBFDMX-UHFFFAOYSA-N |
| Density | 1.701g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.869°C at 760 mmHg (Cal.) |
| Flash point | 198.704°C (Cal.) |
| Refractive index | 1.458 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(Pentafluorophenyl) 2,2'-Oxydiacetate |