|
CAS#: 15862-16-5 Product: 2-Nitro-N-Nitrosophenacetin No suppilers available for the product. |
| Name | 2-Nitro-N-Nitrosophenacetin |
|---|---|
| Synonyms | N-(4-Ethoxy-2-Nitro-Phenyl)-N-Nitroso-Acetamide; N-(4-Ethoxy-2-Nitro-Phenyl)-N-Nitroso-Ethanamide; Acetamide, N-(4-Ethoxy-2-Nitrophenyl)-N-Nitroso- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11N3O5 |
| Molecular Weight | 253.21 |
| CAS Registry Number | 15862-16-5 |
| SMILES | C1=C(C(=CC(=C1)OCC)[N+](=O)[O-])N(C(C)=O)N=O |
| InChI | 1S/C10H11N3O5/c1-3-18-8-4-5-9(10(6-8)13(16)17)12(11-15)7(2)14/h4-6H,3H2,1-2H3 |
| InChIKey | HXKVFSCPSAIRKB-UHFFFAOYSA-N |
| Density | 1.366g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.477°C at 760 mmHg (Cal.) |
| Flash point | 199.025°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitro-N-Nitrosophenacetin |