|
CAS#: 15867-02-4 Product: 2-Amino-9-(5-O-Phosphono-beta-D-Ribofuranosyl)-9H-Purine-6-Thiol No suppilers available for the product. |
| Name | 2-Amino-9-(5-O-Phosphono-beta-D-Ribofuranosyl)-9H-Purine-6-Thiol |
|---|---|
| Synonyms | 5'-Guanylic acid, 6-thio-; 6-TG Nucleotide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14N5O7PS |
| Molecular Weight | 379.29 |
| CAS Registry Number | 15867-02-4 |
| SMILES | C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O)N=C(N=C2S)N |
| InChI | 1S/C10H14N5O7PS/c11-10-13-7-4(8(24)14-10)12-2-15(7)9-6(17)5(16)3(22-9)1-21-23(18,19)20/h2-3,5-6,9,16-17H,1H2,(H2,18,19,20)(H3,11,13,14,24)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | BPZXYEUJBFHASJ-UUOKFMHZSA-N |
| Density | 2.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 873.3±75.0°C at 760 mmHg (Cal.) |
| Flash point | 481.9±37.1°C (Cal.) |
| Refractive index | 1.964 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-9-(5-O-Phosphono-beta-D-Ribofuranosyl)-9H-Purine-6-Thiol |