|
CAS#: 158798-83-5 Product: N-((Phenylmethoxy)carbonyl)-L-leucyl-N-ethyl-L-2-aminobutanamide No suppilers available for the product. |
| Name | N-((Phenylmethoxy)carbonyl)-L-leucyl-N-ethyl-L-2-aminobutanamide |
|---|---|
| Synonyms | Phenylmethyl N-[(1S)-5-Amino-6-Ethylamino-1-Isobutyl-2,6-Dioxo-Hexyl]Carbamate; N-[(1S)-5-Amino-6-Ethylamino-1-Isobutyl-2,6-Dioxohexyl]Carbamic Acid Phenylmethyl Ester; N-[(1S)-5-Amino-6-Ethylamino-1-Isobutyl-2,6-Diketo-Hexyl]Carbamic Acid Benzyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.48 |
| CAS Registry Number | 158798-83-5 |
| SMILES | [C@H](C(CCC(C(=O)NCC)N)=O)(NC(=O)OCC1=CC=CC=C1)CC(C)C |
| InChI | 1S/C20H31N3O4/c1-4-22-19(25)16(21)10-11-18(24)17(12-14(2)3)23-20(26)27-13-15-8-6-5-7-9-15/h5-9,14,16-17H,4,10-13,21H2,1-3H3,(H,22,25)(H,23,26)/t16?,17-/m0/s1 |
| InChIKey | RRFZCPNRFPSQMK-DJNXLDHESA-N |
| Density | 1.109g/cm3 (Cal.) |
|---|---|
| Boiling point | 601.078°C at 760 mmHg (Cal.) |
| Flash point | 317.321°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-((Phenylmethoxy)carbonyl)-L-leucyl-N-ethyl-L-2-aminobutanamide |