|
CAS#: 15911-87-2 Product: Stizolobic Acid No suppilers available for the product. |
| Name | Stizolobic Acid |
|---|---|
| Synonyms | 4-[(2S)-2-Amino-3-Hydroxy-3-Oxo-Propyl]-6-Oxo-Pyran-2-Carboxylic Acid; 4-[(2S)-2-Amino-3-Hydroxy-3-Oxopropyl]-6-Oxo-2-Pyrancarboxylic Acid; 4-[(2S)-2-Amino-3-Hydroxy-3-Keto-Propyl]-6-Keto-Pyran-2-Carboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9NO6 |
| Molecular Weight | 227.17 |
| CAS Registry Number | 15911-87-2 |
| SMILES | [C@@H](C(=O)O)(CC1=CC(OC(=C1)C(=O)O)=O)N |
| InChI | 1S/C9H9NO6/c10-5(8(12)13)1-4-2-6(9(14)15)16-7(11)3-4/h2-3,5H,1,10H2,(H,12,13)(H,14,15)/t5-/m0/s1 |
| InChIKey | KQZBVNZAEQASKU-YFKPBYRVSA-N |
| Density | 1.605g/cm3 (Cal.) |
|---|---|
| Boiling point | 528.182°C at 760 mmHg (Cal.) |
| Flash point | 273.235°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Stizolobic Acid |