|
CAS#: 15918-04-4 Product: Ethyl(2-Hydroxypropyl)Thiocarbamoylamidothiophosphoric Acid O,O-Dimethyl Ester No suppilers available for the product. |
| Name | Ethyl(2-Hydroxypropyl)Thiocarbamoylamidothiophosphoric Acid O,O-Dimethyl Ester |
|---|---|
| Synonyms | 3-Dimethoxythiophosphoryl-1-Ethyl-1-(2-Hydroxypropyl)Thiourea; Ai3-27034; O,O-Dimethyl (Ethyl(2-Hydroxypropyl)Thiocarbamoyl)Phosphoramidothidate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H19N2O3PS2 |
| Molecular Weight | 286.34 |
| CAS Registry Number | 15918-04-4 |
| SMILES | C(N(C(N[P](OC)(OC)=S)=S)CC)C(C)O |
| InChI | 1S/C8H19N2O3PS2/c1-5-10(6-7(2)11)8(15)9-14(16,12-3)13-4/h7,11H,5-6H2,1-4H3,(H,9,15,16) |
| InChIKey | YRVAFQUBJSGTBM-UHFFFAOYSA-N |
| Density | 1.277g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.999°C at 760 mmHg (Cal.) |
| Flash point | 164.869°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl(2-Hydroxypropyl)Thiocarbamoylamidothiophosphoric Acid O,O-Dimethyl Ester |