|
CAS#: 159298-83-6 Product: 2-(4-Chlorophenyl)-1-(4-Methyl-1-Piperazinyl)Ethanethione No suppilers available for the product. |
| Name | 2-(4-Chlorophenyl)-1-(4-Methyl-1-Piperazinyl)Ethanethione |
|---|---|
| Synonyms | 1-[2-(4-Chlorophenyl)ethanethioyl]-4-methylpiperazine # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17ClN2S |
| Molecular Weight | 268.81 |
| CAS Registry Number | 159298-83-6 |
| SMILES | S=C(N1CCN(C)CC1)Cc2ccc(Cl)cc2 |
| InChI | 1S/C13H17ClN2S/c1-15-6-8-16(9-7-15)13(17)10-11-2-4-12(14)5-3-11/h2-5H,6-10H2,1H3 |
| InChIKey | XOWUCQOFMKHAOW-UHFFFAOYSA-N |
| Density | 1.22g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.994°C at 760 mmHg (Cal.) |
| Flash point | 178.776°C (Cal.) |
| Refractive index | 1.607 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Chlorophenyl)-1-(4-Methyl-1-Piperazinyl)Ethanethione |