|
CAS#: 159560-06-2 Product: 4'-Ethyl-4-(3,4,5-Trifluorophenyl)-1,1'-Bi(Cyclohexan)-3-Ene No suppilers available for the product. |
| Name | 4'-Ethyl-4-(3,4,5-Trifluorophenyl)-1,1'-Bi(Cyclohexan)-3-Ene |
|---|---|
| Synonyms | Benzene, |
| Molecular Structure | ![]() |
| Molecular Formula | C20H25F3 |
| Molecular Weight | 322.41 |
| CAS Registry Number | 159560-06-2 |
| SMILES | CCC1CCC(CC1)C2CCC(=CC2)c3cc(c(c(c3)F)F)F |
| InChI | 1S/C20H25F3/c1-2-13-3-5-14(6-4-13)15-7-9-16(10-8-15)17-11-18(21)20(23)19(22)12-17/h9,11-15H,2-8,10H2,1H3 |
| InChIKey | ZTTFKJRQMHMHDT-UHFFFAOYSA-N |
| Density | 1.103g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.124°C at 760 mmHg (Cal.) |
| Flash point | 211.424°C (Cal.) |
| Refractive index | 1.505 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Ethyl-4-(3,4,5-Trifluorophenyl)-1,1'-Bi(Cyclohexan)-3-Ene |