|
CAS#: 159752-38-2 Product: 2-[2-(1-Methoxyethyl)phenyl]-3,4-dimethyl-5-phenyl-1,3,2-oxazaborolidine No suppilers available for the product. |
| Name | 2-[2-(1-Methoxyethyl)phenyl]-3,4-dimethyl-5-phenyl-1,3,2-oxazaborolidine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C19H24BNO2 |
| Molecular Weight | 309.21 |
| CAS Registry Number | 159752-38-2 |
| SMILES | B1(N(C(C(O1)c2ccccc2)C)C)c3ccccc3C(C)OC |
| InChI | 1S/C19H24BNO2/c1-14-19(16-10-6-5-7-11-16)23-20(21(14)3)18-13-9-8-12-17(18)15(2)22-4/h5-15,19H,1-4H3 |
| InChIKey | GXLLYQUIKKSXLV-UHFFFAOYSA-N |
| Density | 1.073g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.497°C at 760 mmHg (Cal.) |
| Flash point | 191.78°C (Cal.) |
| Refractive index | 1.556 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[2-(1-Methoxyethyl)phenyl]-3,4-dimethyl-5-phenyl-1,3,2-oxazaborolidine |