|
CAS#: 15990-54-2 Product: Formaldehyde (Triphenylphosphoranylidene)Hydrazone No suppilers available for the product. |
| Name | Formaldehyde (Triphenylphosphoranylidene)Hydrazone |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C19H17N2P |
| Molecular Weight | 304.33 |
| CAS Registry Number | 15990-54-2 |
| SMILES | N(/N=P(c1ccccc1)(c2ccccc2)c3ccccc3)=C |
| InChI | 1S/C19H17N2P/c1-20-21-22(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16H,1H2 |
| InChIKey | PDYWDDVPQVBXEN-UHFFFAOYSA-N |
| Density | 1.08g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.078°C at 760 mmHg (Cal.) |
| Flash point | 228.418°C (Cal.) |
| Refractive index | 1.591 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Formaldehyde (Triphenylphosphoranylidene)Hydrazone |