|
CAS#: 159933-90-1 Product: Palmarumycin Cp(1) No suppilers available for the product. |
| Name | Palmarumycin Cp(1) |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H12O4 |
| Molecular Weight | 316.31 |
| CAS Registry Number | 159933-90-1 |
| SMILES | C3=C1OC5(OC2=CC=CC(=C12)C=C3)C4=C(C(=CC=C4)O)C(C=C5)=O |
| InChI | 1S/C20H12O4/c21-14-7-3-6-13-19(14)15(22)10-11-20(13)23-16-8-1-4-12-5-2-9-17(24-20)18(12)16/h1-11,21H |
| InChIKey | LVOXAJYEGVDSQA-UHFFFAOYSA-N |
| Density | 1.5g/cm3 (Cal.) |
|---|---|
| Boiling point | 602.124°C at 760 mmHg (Cal.) |
| Flash point | 226.779°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Palmarumycin Cp(1) |