|
CAS#: 16008-36-9 Product: Methyldesorphine No suppilers available for the product. |
| Name | Methyldesorphine |
|---|---|
| Synonyms | 4,5Alpha-Epoxy-6,N-Dimethyl-6-Morphinen-3-Ol; 6-Methyl-Delta(Sup 6)-Deoxy-Morphine; Dea No. 9302 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 |
| CAS Registry Number | 16008-36-9 |
| EINECS | 240-139-6 |
| SMILES | [C@@]125C3=C4C[C@H]([C@@H]1CC=C([C@@H]2OC3=C(C=C4)O)C)N(C)CC5 |
| InChI | 1S/C18H21NO2/c1-10-3-5-12-13-9-11-4-6-14(20)16-15(11)18(12,17(10)21-16)7-8-19(13)2/h3-4,6,12-13,17,20H,5,7-9H2,1-2H3/t12-,13+,17-,18-/m0/s1 |
| InChIKey | CUFWYVOFDYVCPM-GGNLRSJOSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.242°C at 760 mmHg (Cal.) |
| Flash point | 209.769°C (Cal.) |
| Controlled Substance | DEA Drug Code Number: 9302 Details |
|---|---|
| CSA Schedule: I | |
| Is Narcotics? Yes | |
| Market Analysis Reports |
| List of Reports Available for Methyldesorphine |