|
CAS#: 16023-30-6 Product: Diethyl(2-Hydroxyethyl)Ammonium Lactate No suppilers available for the product. |
| Name | Diethyl(2-Hydroxyethyl)Ammonium Lactate |
|---|---|
| Synonyms | Diethyl-(2-Hydroxyethyl)Ammonium; 2-Hydroxypropanoate; Diethyl-(2-Hydroxyethyl)Ammonium; Lactate; Diethyl(2-Hydroxyethyl)Ammonium Lactate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H21NO4 |
| Molecular Weight | 207.27 |
| CAS Registry Number | 16023-30-6 |
| EINECS | 240-160-0 |
| SMILES | CC(O)C([O-])=O.C([NH+](CC)CC)CO |
| InChI | 1S/C6H15NO.C3H6O3/c1-3-7(4-2)5-6-8;1-2(4)3(5)6/h8H,3-6H2,1-2H3;2,4H,1H3,(H,5,6) |
| InChIKey | AGXJJJJSMPEISC-UHFFFAOYSA-N |
| Boiling point | 164.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 48.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl(2-Hydroxyethyl)Ammonium Lactate |