|
CAS#: 16048-37-6 Product: 9,10-Dioxoanthracene-1-Diazonium Chloride No suppilers available for the product. |
| Name | 9,10-Dioxoanthracene-1-Diazonium Chloride |
|---|---|
| Synonyms | 9,10-Dioxo-1-Anthracenediazonium Chloride; 9,10-Diketoanthracene-1-Diazonium Chloride; 1-Anthracenediazonium, 9,10-Dihydro-9,10-Dioxo-, Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C14H7ClN2O2 |
| Molecular Weight | 270.67 |
| CAS Registry Number | 16048-37-6 |
| EINECS | 240-192-5 |
| SMILES | C1=C2C(=C(C=C1)[N+]#N)C(C3=C(C2=O)C=CC=C3)=O.[Cl-] |
| InChI | 1S/C14H7N2O2.ClH/c15-16-11-7-3-6-10-12(11)14(18)9-5-2-1-4-8(9)13(10)17;/h1-7H;1H/q+1;/p-1 |
| InChIKey | QAJMZRMIUJJTBN-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for 9,10-Dioxoanthracene-1-Diazonium Chloride |