|
CAS#: 160568-13-8 Product: 6',8-Desmethylthalifaberine No suppilers available for the product. |
| Name | 6',8-Desmethylthalifaberine |
|---|---|
| Synonyms | Nci60_027040; Nsc676431; Thalifaberidine |
| Molecular Structure | ![]() |
| Molecular Formula | C39H44N2O8 |
| Molecular Weight | 668.79 |
| CAS Registry Number | 160568-13-8 |
| SMILES | [C@@H]14N(CCC2=C1C(=C(OC)C(=C2OC)OC)C3=CC(=C(O)C(=C3C4)OC5=CC=C(C=C5)C[C@@H]6N(CCC7=C6C=C(OC)C(=C7)O)C)OC)C |
| InChI | 1S/C39H44N2O8/c1-40-14-12-22-17-30(42)31(44-3)19-25(22)28(40)16-21-8-10-23(11-9-21)49-36-27-18-29-33-24(13-15-41(29)2)37(46-5)39(48-7)38(47-6)34(33)26(27)20-32(45-4)35(36)43/h8-11,17,19-20,28-29,42-43H,12-16,18H2,1-7H3/t28-,29-/m0/s1 |
| InChIKey | ASHXFBBPKYCWEY-VMPREFPWSA-N |
| Density | 1.256g/cm3 (Cal.) |
|---|---|
| Boiling point | 764.708°C at 760 mmHg (Cal.) |
| Flash point | 416.28°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6',8-Desmethylthalifaberine |