|
CAS#: 16067-01-9 Product: 1-Nitro-2-Octanone No suppilers available for the product. |
| Name | 1-Nitro-2-Octanone |
|---|---|
| Synonyms | 2-Octanone, 1-Nitro-; 1-Nitro-2-Octanone |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 |
| CAS Registry Number | 16067-01-9 |
| SMILES | C([N+]([O-])=O)C(=O)CCCCCC |
| InChI | 1S/C8H15NO3/c1-2-3-4-5-6-8(10)7-9(11)12/h2-7H2,1H3 |
| InChIKey | CRGCBMPLEALRLX-UHFFFAOYSA-N |
| Density | 1.016g/cm3 (Cal.) |
|---|---|
| Boiling point | 251.25°C at 760 mmHg (Cal.) |
| Flash point | 99.05°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitro-2-Octanone |