Online Database of Chemicals from Around the World
| Florida Center for Heterocyclic Compounds | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (352) 392-0554 | |||
 |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | 1-Dimethylamino-4-Trimethylsilylbenzene |
|---|---|
| Synonyms | N,N-Dimethyl-4-Trimethylsilyl-Aniline; Dimethyl-(4-Trimethylsilylphenyl)Amine; 1-Dimethylamino-4-Trimethylsilylbenzene |
| Molecular Structure |  |
| Molecular Formula | C11H19NSi |
| Molecular Weight | 193.36 |
| CAS Registry Number | 16087-24-4 |
| SMILES | C1=C(C=CC(=C1)N(C)C)[Si](C)(C)C |
| InChI | 1S/C11H19NSi/c1-12(2)10-6-8-11(9-7-10)13(3,4)5/h6-9H,1-5H3 |
| InChIKey | XWSAQLPVZORNHH-UHFFFAOYSA-N |
| Density | 0.903g/cm3 (Cal.) |
|---|---|
| Boiling point | 253.724°C at 760 mmHg (Cal.) |
| Flash point | 107.249°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Dimethylamino-4-Trimethylsilylbenzene |