| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| SobhaBio | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (99) 8988-2177 | |||
![]() |
siva@sobhabio.com | |||
| Chemical manufacturer since 2010 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 2,6-Dimethyl-4H-Chromen-4-One |
|---|---|
| Synonyms | 2,6-dimethylchromen-4-one; ZINC00040326 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 |
| CAS Registry Number | 16108-51-3 |
| SMILES | O=C\1c2c(O/C(=C/1)C)ccc(c2)C |
| InChI | 1S/C11H10O2/c1-7-3-4-11-9(5-7)10(12)6-8(2)13-11/h3-6H,1-2H3 |
| InChIKey | ICLIZHYTACTNJW-UHFFFAOYSA-N |
| Density | 1.151g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.123°C at 760 mmHg (Cal.) |
| Flash point | 127.757°C (Cal.) |
| Refractive index | 1.565 (Cal.) |
| (1) | B. Arslan, C. Kazak and H. Göker. 2,6-Dimethyl-4H-1-benzopyran-4-one, Acta Cryst. (2004). E60, o2238-o2240 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,6-Dimethyl-4H-Chromen-4-One |