|
CAS#: 161334-04-9 Product: 1-(3-Nitropyren-1-Yl)Ethanone No suppilers available for the product. |
| Name | 1-(3-Nitropyren-1-Yl)Ethanone |
|---|---|
| Synonyms | 1-(3-Nitro-1-Pyrenyl)Ethanone; 1-(3-Nitro-1-Pyrenyl)-Ethanone |
| Molecular Structure | ![]() |
| Molecular Formula | C18H11NO3 |
| Molecular Weight | 289.29 |
| CAS Registry Number | 161334-04-9 |
| SMILES | C2=C(C1=CC=C4C3=C1C(=C2[N+]([O-])=O)C=CC3=CC=C4)C(=O)C |
| InChI | 1S/C18H11NO3/c1-10(20)15-9-16(19(21)22)14-8-6-12-4-2-3-11-5-7-13(15)18(14)17(11)12/h2-9H,1H3 |
| InChIKey | AXAFHZQFUHIWOR-UHFFFAOYSA-N |
| Density | 1.409g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.033°C at 760 mmHg (Cal.) |
| Flash point | 225.572°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Nitropyren-1-Yl)Ethanone |