|
CAS#: 16169-16-7 Product: 4-Nitrophenylhydroxylamine No suppilers available for the product. |
| Name | 4-Nitrophenylhydroxylamine |
|---|---|
| Synonyms | 4-15-00-00014 (Beilstein Handbook Reference); 4-Nitrophenylhydroxylamine; Brn 2208880 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6N2O3 |
| Molecular Weight | 154.13 |
| CAS Registry Number | 16169-16-7 |
| SMILES | C1=CC(=CC=C1NO)[N+]([O-])=O |
| InChI | 1S/C6H6N2O3/c9-7-5-1-3-6(4-2-5)8(10)11/h1-4,7,9H |
| InChIKey | XXFXVCXUJCOLSU-UHFFFAOYSA-N |
| Density | 1.515g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.79°C at 760 mmHg (Cal.) |
| Flash point | 154.461°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitrophenylhydroxylamine |