|
CAS#: 16184-59-1 Product: Bis(Pentafluorophenyl)-1,3,4-Oxadiazole No suppilers available for the product. |
| Name | Bis(Pentafluorophenyl)-1,3,4-Oxadiazole |
|---|---|
| Synonyms | 1,3,4-Oxadiazole, 2,5-Bis(Pentafluorophenyl)-; 2,5-Di(Pentafluorophenyl)-1,3,4-Oxadiazole; Nsc170093 |
| Molecular Structure | ![]() |
| Molecular Formula | C14F10N2O |
| Molecular Weight | 402.15 |
| CAS Registry Number | 16184-59-1 |
| SMILES | C1(=C(C(=C(F)C(=C1F)F)F)F)C2=NN=C(O2)C3=C(C(=C(F)C(=C3F)F)F)F |
| InChI | 1S/C14F10N2O/c15-3-1(4(16)8(20)11(23)7(3)19)13-25-26-14(27-13)2-5(17)9(21)12(24)10(22)6(2)18 |
| InChIKey | IXTLPVLHPRQLGS-UHFFFAOYSA-N |
| Density | 1.738g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.426°C at 760 mmHg (Cal.) |
| Flash point | 167.546°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(Pentafluorophenyl)-1,3,4-Oxadiazole |