|
CAS#: 161869-03-0 Product: (2S)-2-Benzhydryl-3-Methoxy-3-Oxo-Propanoic Acid No suppilers available for the product. |
| Name | (2S)-2-Benzhydryl-3-Methoxy-3-Oxo-Propanoic Acid |
|---|---|
| Synonyms | (S)-2-(methoxycarbonyl)-3,3-diphenylpropanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 |
| CAS Registry Number | 161869-03-0 |
| SMILES | COC(=O)[C@@H](C(C1=CC=CC=C1)C2=CC=CC=C2)C(=O)O |
| InChI | 1S/C17H16O4/c1-21-17(20)15(16(18)19)14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11,14-15H,1H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | MJOIFVQVKWJWTB-HNNXBMFYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.6±33.0°C at 760 mmHg (Cal.) |
| Flash point | 153.4±18.9°C (Cal.) |
| Refractive index | 1.575 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-Benzhydryl-3-Methoxy-3-Oxo-Propanoic Acid |