|
CAS#: 1619-87-0 Product: 1-Methoxy-4-(Vinylsulfonyl)Benzene No suppilers available for the product. |
| Name | 1-Methoxy-4-(Vinylsulfonyl)Benzene |
|---|---|
| Synonyms | 1-Methoxy-4-(vinylsulfonyl)benzene #; 4-Methoxyphenylvinylsulphone |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10O3S |
| Molecular Weight | 198.24 |
| CAS Registry Number | 1619-87-0 |
| SMILES | O=S(=O)(c1ccc(OC)cc1)\C=C |
| InChI | 1S/C9H10O3S/c1-3-13(10,11)9-6-4-8(12-2)5-7-9/h3-7H,1H2,2H3 |
| InChIKey | XGBPVKHLRWYNHW-UHFFFAOYSA-N |
| Density | 1.188g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.277°C at 760 mmHg (Cal.) |
| Flash point | 166.851°C (Cal.) |
| Refractive index | 1.523 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methoxy-4-(Vinylsulfonyl)Benzene |