|
CAS#: 16204-69-6 Product: 3,3,5,6,7-Pentamethyl-1-Indanone No suppilers available for the product. |
| Name | 3,3,5,6,7-Pentamethyl-1-Indanone |
|---|---|
| Synonyms | 3,3,5,6,7-Pentamethyl-1-indanone # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.29 |
| CAS Registry Number | 16204-69-6 |
| SMILES | O=C2c1c(cc(c(c1C)C)C)C(C2)(C)C |
| InChI | 1S/C14H18O/c1-8-6-11-13(10(3)9(8)2)12(15)7-14(11,4)5/h6H,7H2,1-5H3 |
| InChIKey | LJWSSBMIPRWJRH-UHFFFAOYSA-N |
| Density | 1g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.744°C at 760 mmHg (Cal.) |
| Flash point | 139.61°C (Cal.) |
| Refractive index | 1.529 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,5,6,7-Pentamethyl-1-Indanone |