Online Database of Chemicals from Around the World
|
CAS#: 1621-84-7 Product: 5,7-Dihydroxy-2-(2,4,5-Trihydroxyphenyl)-4H-1-Benzopyran-4-One No suppilers available for the product. |
| Name | 5,7-Dihydroxy-2-(2,4,5-Trihydroxyphenyl)-4H-1-Benzopyran-4-One |
|---|---|
| Synonyms | 5,7-Dihydroxy-2-(2,4,5-Trihydroxyphenyl)-4-Chromenone; 5,7-Dihydroxy-2-(2,4,5-Trihydroxyphenyl)Chromone; 5,7,2',4',5'-Pentahydroxyflavone |
| Molecular Structure |  |
| Molecular Formula | C15H10O7 |
| Molecular Weight | 302.24 |
| CAS Registry Number | 1621-84-7 |
| SMILES | C3=C(C1=CC(C2=C(O1)C=C(O)C=C2O)=O)C(=CC(=C3O)O)O |
| InChI | 1S/C15H10O7/c16-6-1-11(20)15-12(21)5-13(22-14(15)2-6)7-3-9(18)10(19)4-8(7)17/h1-5,16-20H |
| InChIKey | DSNIERNBMAVNJI-UHFFFAOYSA-N |
| Density | 1.763g/cm3 (Cal.) |
|---|---|
| Boiling point | 682.421°C at 760 mmHg (Cal.) |
| Flash point | 263.337°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,7-Dihydroxy-2-(2,4,5-Trihydroxyphenyl)-4H-1-Benzopyran-4-One |