|
CAS#: 16248-90-1 Product: Bis(Diethyldithiocarbamic Acid) Tin(II) Salt No suppilers available for the product. |
| Name | Bis(Diethyldithiocarbamic Acid) Tin(II) Salt |
|---|---|
| Synonyms | Stannous Diethylaminomethanedithioate; Tin Bis(Diethyldithiocarbamate); Tin, Bis(Diethylcarbamodithioato)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H20N2S4Sn |
| Molecular Weight | 415.21 |
| CAS Registry Number | 16248-90-1 |
| SMILES | C(N(C([S-])=S)CC)C.C(N(C([S-])=S)CC)C.[Sn++] |
| InChI | 1S/2C5H11NS2.Sn/c2*1-3-6(4-2)5(7)8;/h2*3-4H2,1-2H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | UXPVPFVRBBOKPF-UHFFFAOYSA-L |
| Boiling point | 176.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 60.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(Diethyldithiocarbamic Acid) Tin(II) Salt |