|
CAS#: 16271-53-7 Product: beta-Homobetaine Methyl Ester perchlorate No suppilers available for the product. |
| Name | beta-Homobetaine Methyl Ester perchlorate |
|---|---|
| Synonyms | (3-Methoxy-3-Oxo-Propyl)-Trimethyl-Ammonium Perchlorate; (3-Methoxy-3-Oxopropyl)-Trimethylammonium Perchlorate; (3-Keto-3-Methoxy-Propyl)-Trimethyl-Ammonium Perchlorate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H16ClNO6 |
| Molecular Weight | 245.66 |
| CAS Registry Number | 16271-53-7 |
| SMILES | O=[Cl]([O-])(=O)=O.C([N+](C)(C)C)CC(OC)=O |
| InChI | 1S/C7H16NO2.ClHO4/c1-8(2,3)6-5-7(9)10-4;2-1(3,4)5/h5-6H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | BUDCQHPWPHLPBK-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for beta-Homobetaine Methyl Ester perchlorate |