|
CAS#: 16281-94-0 Product: Dimethyl 4-(Bromomethyl)Isophthalate No suppilers available for the product. |
| Name | Dimethyl 4-(Bromomethyl)Isophthalate |
|---|---|
| Synonyms | dimethyl 4-(bromomethyl)isophthalate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11BrO4 |
| Molecular Weight | 287.11 |
| CAS Registry Number | 16281-94-0 |
| SMILES | BrCc1ccc(cc1C(=O)OC)C(=O)OC |
| InChI | 1S/C11H11BrO4/c1-15-10(13)7-3-4-8(6-12)9(5-7)11(14)16-2/h3-5H,6H2,1-2H3 |
| InChIKey | ANRZBUXUDASAAN-UHFFFAOYSA-N |
| Density | 1.475g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.009°C at 760 mmHg (Cal.) |
| Flash point | 181.204°C (Cal.) |
| Refractive index | 1.554 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 4-(Bromomethyl)Isophthalate |