|
CAS#: 162871-02-5 Product: (1S,2R)-1-Amino-2-Isopropylcyclopropanecarboxylic Acid No suppilers available for the product. |
| Name | (1S,2R)-1-Amino-2-Isopropylcyclopropanecarboxylic Acid |
|---|---|
| Synonyms | (1S,2R)-1-amino-2-isopropylcyclopropanecarboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.18 |
| CAS Registry Number | 162871-02-5 |
| SMILES | CC(C)[C@H]1C[C@]1(C(=O)O)N |
| InChI | 1S/C7H13NO2/c1-4(2)5-3-7(5,8)6(9)10/h4-5H,3,8H2,1-2H3,(H,9,10)/t5-,7+/m1/s1 |
| InChIKey | GFIRYOYQBKQVOL-VDTYLAMSSA-N |
| Density | 1.158g/cm3 (Cal.) |
|---|---|
| Boiling point | 244.396°C at 760 mmHg (Cal.) |
| Flash point | 101.607°C (Cal.) |
| Refractive index | 1.515 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,2R)-1-Amino-2-Isopropylcyclopropanecarboxylic Acid |