|
CAS#: 16293-79-1 Product: cis-4b,5,9b,10-Tetrahydroindeno[2,1-a]Indene No suppilers available for the product. |
| Name | cis-4b,5,9b,10-Tetrahydroindeno[2,1-a]Indene |
|---|---|
| Synonyms | Cis-4B,5,9B,10-Tetrahydroindeno(2,1-A)Indene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 |
| CAS Registry Number | 16293-79-1 |
| EINECS | 240-384-9 |
| SMILES | [C@@H]13[C@@H](C2=C(C1)C=CC=C2)CC4=C3C=CC=C4 |
| InChI | 1S/C16H14/c1-3-7-13-11(5-1)9-15-14-8-4-2-6-12(14)10-16(13)15/h1-8,15-16H,9-10H2/t15-,16-/m1/s1 |
| InChIKey | WAOYYDRELAGSPG-HZPDHXFCSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 280.56°C at 760 mmHg (Cal.) |
| Flash point | 122.992°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for cis-4b,5,9b,10-Tetrahydroindeno[2,1-a]Indene |