|
CAS#: 16329-23-0 Product: (1R,2S,3R,4S)-Bicyclo[2.2.1]Heptane-2,3-Diol No suppilers available for the product. |
| Name | (1R,2S,3R,4S)-Bicyclo[2.2.1]Heptane-2,3-Diol |
|---|---|
| Synonyms | exo,exo-norbornane-2,3-diol |
| Molecular Structure | ![]() |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 |
| CAS Registry Number | 16329-23-0 |
| SMILES | C1C[C@H]2C[C@@H]1[C@@H]([C@@H]2O)O |
| InChI | 1S/C7H12O2/c8-6-4-1-2-5(3-4)7(6)9/h4-9H,1-3H2/t4-,5+,6+,7- |
| InChIKey | HNMVZUWXQLASRL-RNGGSSJXSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.9±8.0°C at 760 mmHg (Cal.) |
| Flash point | 143.6±13.0°C (Cal.) |
| Refractive index | 1.591 (Cal.) |
| (1) | Hai-Shan Dang, Brian P. Roberts and Derek A. Tocher. Thiol-catalysed radical-chain redox rearrangement reactions of benzylidene acetals derived from terpenoid diols, Org. Biomol. Chem., 2003, 1, 4073. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (1R,2S,3R,4S)-Bicyclo[2.2.1]Heptane-2,3-Diol |