|
CAS#: 16339-01-8 Product: N-Nitroso-4-Methylaminoazobenzene No suppilers available for the product. |
| Name | N-Nitroso-4-Methylaminoazobenzene |
|---|---|
| Synonyms | N-Methyl-N-(4-Phenylazophenyl)Nitrous Amide; 4-Methylamino-N-Nitrosoazobenzene; Aniline, N-Methyl-N-Nitroso-4-(Phenylazo)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.26 |
| CAS Registry Number | 16339-01-8 |
| SMILES | C1=C(N(N=O)C)C=CC(=C1)N=NC2=CC=CC=C2 |
| InChI | 1S/C13H12N4O/c1-17(16-18)13-9-7-12(8-10-13)15-14-11-5-3-2-4-6-11/h2-10H,1H3 |
| InChIKey | YKCOXSGBLMSJLH-UHFFFAOYSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.899°C at 760 mmHg (Cal.) |
| Flash point | 219.843°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Nitroso-4-Methylaminoazobenzene |