Online Database of Chemicals from Around the World
|
CAS#: 16344-98-2 Product: 3,5-Diiodo-4-Oxo-1(4H)-Pyridinevaleric Acid No suppilers available for the product. |
| Name | 3,5-Diiodo-4-Oxo-1(4H)-Pyridinevaleric Acid |
|---|---|
| Synonyms | 5-(3,5-Diiodo-4-Oxo-1-Pyridyl)Pentanoic Acid; 5-(3,5-Diiodo-4-Keto-1-Pyridyl)Valeric Acid; 5-(3,5-Diiodo-4-Oxo-Pyridin-1-Yl)Pentanoic Acid |
| Molecular Structure |  |
| Molecular Formula | C10H11I2NO3 |
| Molecular Weight | 447.01 |
| CAS Registry Number | 16344-98-2 |
| SMILES | C(N1C=C(I)C(=O)C(=C1)I)CCCC(=O)O |
| InChI | 1S/C10H11I2NO3/c11-7-5-13(6-8(12)10(7)16)4-2-1-3-9(14)15/h5-6H,1-4H2,(H,14,15) |
| InChIKey | QVAWNGWADTXLBI-UHFFFAOYSA-N |
| Density | 2.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.951°C at 760 mmHg (Cal.) |
| Flash point | 232.575°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Diiodo-4-Oxo-1(4H)-Pyridinevaleric Acid |