|
CAS#: 16354-50-0 Product: 7-Ethyl-12-Methylbenz(a)Anthracene No suppilers available for the product. |
| Name | 7-Ethyl-12-Methylbenz(a)Anthracene |
|---|---|
| Synonyms | 7-Ethyl-12-Methyl-Benzo[B]Phenanthrene; Benz(A)Anthracene, 7-Ethyl-12-Methyl-; Ccris 1535 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.37 |
| CAS Registry Number | 16354-50-0 |
| SMILES | C2=CC4=C(C3=C(C1=CC=CC=C1C(=C23)CC)C)C=CC=C4 |
| InChI | 1S/C21H18/c1-3-16-19-11-7-6-9-17(19)14(2)21-18-10-5-4-8-15(18)12-13-20(16)21/h4-13H,3H2,1-2H3 |
| InChIKey | KGHAOMPXHGIHAL-UHFFFAOYSA-N |
| Density | 1.122g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.472°C at 760 mmHg (Cal.) |
| Flash point | 232.557°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Ethyl-12-Methylbenz(a)Anthracene |