| Name | 3-Chloro-4-(2-Amino-3-Chlorophenyl)Pyrrole |
|---|---|
| Synonyms | [2-Chloro-6-(4-Chloro-1H-Pyrrol-3-Yl)Phenyl]Amine; 2-Chloro-6-(4-Chloro-1H-Pyrrol-3-Yl)Phenylamine; 3-Chloro-4-(2-Amino-3-Chlorophenyl)Pyrrole |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8Cl2N2 |
| Molecular Weight | 227.09 |
| CAS Registry Number | 16386-65-5 |
| SMILES | C2=C(C1=CC=CC(=C1N)Cl)C(=C[NH]2)Cl |
| InChI | 1S/C10H8Cl2N2/c11-8-3-1-2-6(10(8)13)7-4-14-5-9(7)12/h1-5,14H,13H2 |
| InChIKey | RWAXAHFFXZKMPA-UHFFFAOYSA-N |
| Density | 1.426g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.673°C at 760 mmHg (Cal.) |
| Flash point | 181.001°C (Cal.) |
| (1) | Sydor Paulina K., Barry Sarah M., Odulate Olanipekun M., Barona-Gomez Francisco, Haynes Stuart W., Corre Christophe, Song Lijiang, Challis Gregory L.. Regio- and stereodivergent antibiotic oxidative carbocyclizations catalysed by Rieske oxygenase-like enzymes, Nature Chemistry, 2011 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-4-(2-Amino-3-Chlorophenyl)Pyrrole |