Online Database of Chemicals from Around the World
|
CAS#: 163879-74-1 Product: 4-[(4-Carbamoylphenyl)Diazenyl]-3-Hydroxy-N-(3-Nitrophenyl)-2-Naphthamide No suppilers available for the product. |
| Name | 4-[(4-Carbamoylphenyl)Diazenyl]-3-Hydroxy-N-(3-Nitrophenyl)-2-Naphthamide |
|---|---|
| Molecular Structure | ![CAS#: 163879-74-1, 4-[(4-Carbamoylphenyl)Diazenyl]-3-Hydroxy-N-(3-Nitrophenyl)-2-Naphthamide](/moreStructures/163879-74-1.gif) |
| Molecular Formula | C24H17N5O5 |
| Molecular Weight | 455.42 |
| CAS Registry Number | 163879-74-1 |
| SMILES | c1ccc2c(c1)cc(c(c2N=Nc3ccc(cc3)C(=O)N)O)C(=O)Nc4cccc(c4)[N+](=O)[O-] |
| InChI | 1S/C24H17N5O5/c25-23(31)14-8-10-16(11-9-14)27-28-21-19-7-2-1-4-15(19)12-20(22(21)30)24(32)26-17-5-3-6-18(13-17)29(33)34/h1-13,30H,(H2,25,31)(H,26,32) |
| InChIKey | RVOBKOOOFOJPMR-UHFFFAOYSA-N |
| Density | 1.457g/cm3 (Cal.) |
|---|---|
| Boiling point | 679.605°C at 760 mmHg (Cal.) |
| Flash point | 364.812°C (Cal.) |
| Refractive index | 1.71 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(4-Carbamoylphenyl)Diazenyl]-3-Hydroxy-N-(3-Nitrophenyl)-2-Naphthamide |