|
CAS#: 164012-31-1 Product: 6-Bromo-4,4-Dimethyl-2-Chromanone No suppilers available for the product. |
| Name | 6-Bromo-4,4-Dimethyl-2-Chromanone |
|---|---|
| Synonyms | 6-bromo-4,4-dimethylchroman-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11BrO2 |
| Molecular Weight | 255.11 |
| CAS Registry Number | 164012-31-1 |
| SMILES | Brc1ccc2OC(=O)CC(C)(C)c2c1 |
| InChI | 1S/C11H11BrO2/c1-11(2)6-10(13)14-9-4-3-7(12)5-8(9)11/h3-5H,6H2,1-2H3 |
| InChIKey | ZMEGAKQYQYQIHK-UHFFFAOYSA-N |
| Density | 1.43g/cm3 (Cal.) |
|---|---|
| Boiling point | 308.36°C at 760 mmHg (Cal.) |
| Flash point | 140.292°C (Cal.) |
| Refractive index | 1.554 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Bromo-4,4-Dimethyl-2-Chromanone |