|
CAS#: 164124-12-3 Product: 3-Methyl-4H-Pyrido[3,2-e][1,2,4]Thiadiazine 1,1-Dioxide No suppilers available for the product. |
| Name | 3-Methyl-4H-Pyrido[3,2-e][1,2,4]Thiadiazine 1,1-Dioxide |
|---|---|
| Synonyms | 3-methyl-2H-pyrido[3,2-e][1,2,4]thiadiazine 1,1-dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.21 |
| CAS Registry Number | 164124-12-3 |
| SMILES | CC1=NS(=O)(=O)C2=C(N1)C=CC=N2 |
| InChI | 1S/C7H7N3O2S/c1-5-9-6-3-2-4-8-7(6)13(11,12)10-5/h2-4H,1H3,(H,9,10) |
| InChIKey | PBPMLDLIJXVMQP-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.4±37.0°C at 760 mmHg (Cal.) |
| Flash point | 204.4±26.5°C (Cal.) |
| Refractive index | 1.727 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-4H-Pyrido[3,2-e][1,2,4]Thiadiazine 1,1-Dioxide |