|
CAS#: 16424-98-9 Product: 1-(2,4-Dinitrophenyl)-2-(2-Heptylidenecyclopentylidene)Hydrazine No suppilers available for the product. |
| Name | 1-(2,4-Dinitrophenyl)-2-(2-Heptylidenecyclopentylidene)Hydrazine |
|---|---|
| Synonyms | Cyclopentanone, 2-heptylidene-, (2,4-dinitrophenyl)hydrazone; NSC 230190 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 |
| CAS Registry Number | 16424-98-9 |
| SMILES | [O-][N+](=O)c1ccc(c([N+]([O-])=O)c1)NN=C2C(=CCCCCCC)CCC2 |
| InChI | 1S/C18H24N4O4/c1-2-3-4-5-6-8-14-9-7-10-16(14)19-20-17-12-11-15(21(23)24)13-18(17)22(25)26/h8,11-13,20H,2-7,9-10H2,1H3 |
| InChIKey | QSLDBABBZLIKDV-UHFFFAOYSA-N |
| Density | 1.267g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.8°C at 760 mmHg (Cal.) |
| Flash point | 254.861°C (Cal.) |
| Refractive index | 1.602 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,4-Dinitrophenyl)-2-(2-Heptylidenecyclopentylidene)Hydrazine |