|
CAS#: 16431-85-9 Product: N,N,N-Trimethylmethanaminium Propenoic Acidanion No suppilers available for the product. |
| Name | N,N,N-Trimethylmethanaminium Propenoic Acidanion |
|---|---|
| Synonyms | Prop-2-Enoate; Tetramethylammonium; Acrylate; Tetramethylammonium; Tetramethylammonium Acrylate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 |
| CAS Registry Number | 16431-85-9 |
| SMILES | O=C([O-])C=C.C[N+](C)(C)C |
| InChI | 1S/C4H12N.C3H4O2/c1-5(2,3)4;1-2-3(4)5/h1-4H3;2H,1H2,(H,4,5)/q+1;/p-1 |
| InChIKey | UBUNGTDUKIRAGR-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for N,N,N-Trimethylmethanaminium Propenoic Acidanion |