|
CAS#: 16460-56-3 Product: 1,2,3,4-Tetrahydro-2,3-Diphenyl-Phthalazine No suppilers available for the product. |
| Name | 1,2,3,4-Tetrahydro-2,3-Diphenyl-Phthalazine |
|---|---|
| Synonyms | Phthalazine,1,2,3,4-Tetrahydro-2,3-Diphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H18N2 |
| Molecular Weight | 286.38 |
| CAS Registry Number | 16460-56-3 |
| SMILES | C1=CC=C2C(=C1)CN(N(C2)C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | 1S/C20H18N2/c1-3-11-19(12-4-1)21-15-17-9-7-8-10-18(17)16-22(21)20-13-5-2-6-14-20/h1-14H,15-16H2 |
| InChIKey | RTAUPKZNXSQIGT-UHFFFAOYSA-N |
| Density | 1.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.392°C at 760 mmHg (Cal.) |
| Flash point | 190.956°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4-Tetrahydro-2,3-Diphenyl-Phthalazine |