Online Database of Chemicals from Around the World
|
CAS#: 16486-94-5 Product: Octadecafluoro-9-(Trifluoromethyl)Decanoic Acid No suppilers available for the product. |
| Name | Octadecafluoro-9-(Trifluoromethyl)Decanoic Acid |
|---|---|
| Synonyms | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-Octadecafluoro-9-(Trifluoromethyl)Capric Acid; Octadecafluoro-9-(Trifluoromethyl)Decanoic Acid |
| Molecular Structure |  |
| Molecular Formula | C11HF21O2 |
| Molecular Weight | 564.09 |
| CAS Registry Number | 16486-94-5 |
| EINECS | 240-544-8 |
| SMILES | O=C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
| InChI | 1S/C11HF21O2/c12-2(13,1(33)34)4(15,16)6(19,20)8(23,24)9(25,26)7(21,22)5(17,18)3(14,10(27,28)29)11(30,31)32/h(H,33,34) |
| InChIKey | FTUYMACVNWCLNM-UHFFFAOYSA-N |
| Density | 1.765g/cm3 (Cal.) |
|---|---|
| Boiling point | 221.506°C at 760 mmHg (Cal.) |
| Flash point | 87.764°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Octadecafluoro-9-(Trifluoromethyl)Decanoic Acid |