|
CAS#: 16501-01-2 Product: Mono(2-Methoxyethyl) Phthalate No suppilers available for the product. |
| Name | Mono(2-Methoxyethyl) Phthalate |
|---|---|
| Synonyms | 2-(2-Methoxyethoxy-Oxomethyl)Benzoic Acid; 1,2-Benzenedicarboxylic Acid, Mono(2-Methoxyethyl) Ester; 3-09-00-04172 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 |
| CAS Registry Number | 16501-01-2 |
| SMILES | C1=CC(=C(C=C1)C(=O)OCCOC)C(=O)O |
| InChI | 1S/C11H12O5/c1-15-6-7-16-11(14)9-5-3-2-4-8(9)10(12)13/h2-5H,6-7H2,1H3,(H,12,13) |
| InChIKey | NGFWAKGWMSOVMP-UHFFFAOYSA-N |
| Density | 1.251g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.905°C at 760 mmHg (Cal.) |
| Flash point | 132.843°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mono(2-Methoxyethyl) Phthalate |