|
CAS#: 165036-27-1 Product: Methyl (2S,3S)-3-Methyl-4-Oxo-2-Azetidinecarboxylate No suppilers available for the product. |
| Name | Methyl (2S,3S)-3-Methyl-4-Oxo-2-Azetidinecarboxylate |
|---|---|
| Synonyms | (2S,3S)-methyl 3-methyl-4-oxoazetidine-2-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 |
| CAS Registry Number | 165036-27-1 |
| SMILES | C[C@H]1[C@H](NC1=O)C(=O)OC |
| InChI | 1S/C6H9NO3/c1-3-4(6(9)10-2)7-5(3)8/h3-4H,1-2H3,(H,7,8)/t3-,4-/m0/s1 |
| InChIKey | AXVUWGFDZVMNDE-IMJSIDKUSA-N |
| Density | 1.182g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.068°C at 760 mmHg (Cal.) |
| Flash point | 128.019°C (Cal.) |
| Refractive index | 1.457 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (2S,3S)-3-Methyl-4-Oxo-2-Azetidinecarboxylate |