|
CAS#: 16528-78-2 Product: Sodiumdicyclohexyldithiocarbamate No suppilers available for the product. |
| Name | Sodiumdicyclohexyldithiocarbamate |
|---|---|
| Synonyms | 2Ts6d; Carbamic Acid, Dicyclohexyldithio-, Sodium Salt; Carbamodithioic Acid, Dicyclohexyl-, Sodium Salt (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22NNaS2 |
| Molecular Weight | 279.43 |
| CAS Registry Number | 16528-78-2 |
| SMILES | C2C(N(C1CCCCC1)C([S-])=S)CCCC2.[Na+] |
| InChI | 1S/C13H23NS2.Na/c15-13(16)14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h11-12H,1-10H2,(H,15,16);/q;+1/p-1 |
| InChIKey | ZNULMQROJUXSKX-UHFFFAOYSA-M |
| Boiling point | 349.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 165.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodiumdicyclohexyldithiocarbamate |