|
CAS#: 16544-21-1 Product: 2-Fluoro-2,2-Dinitroethyl Acrylate No suppilers available for the product. |
| Name | 2-Fluoro-2,2-Dinitroethyl Acrylate |
|---|---|
| Synonyms | (2-Fluoro-2,2-Dinitro-Ethyl) Prop-2-Enoate; Prop-2-Enoic Acid (2-Fluoro-2,2-Dinitroethyl) Ester; Acrylic Acid (2-Fluoro-2,2-Dinitro-Ethyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C5H5FN2O6 |
| Molecular Weight | 208.10 |
| CAS Registry Number | 16544-21-1 |
| EINECS | 240-609-0 |
| SMILES | C(OC(=O)C=C)C(F)([N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C5H5FN2O6/c1-2-4(9)14-3-5(6,7(10)11)8(12)13/h2H,1,3H2 |
| InChIKey | SVLVXRRQKCWWRO-UHFFFAOYSA-N |
| Density | 1.479g/cm3 (Cal.) |
|---|---|
| Boiling point | 268.726°C at 760 mmHg (Cal.) |
| Flash point | 116.322°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Fluoro-2,2-Dinitroethyl Acrylate |