|
CAS#: 16551-96-5 Product: 3-Amino-1-Hydroxy-2(1H)-Quinolinone No suppilers available for the product. |
| Name | 3-Amino-1-Hydroxy-2(1H)-Quinolinone |
|---|---|
| Synonyms | 3-Amino-1-hydroxy-2(1H)-quinolinone # |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 |
| CAS Registry Number | 16551-96-5 |
| SMILES | O=C2/C(=C\c1c(cccc1)N2O)N |
| InChI | 1S/C9H8N2O2/c10-7-5-6-3-1-2-4-8(6)11(13)9(7)12/h1-5,13H,10H2 |
| InChIKey | JREFLKGIMBMLNU-UHFFFAOYSA-N |
| Density | 1.472g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.042°C at 760 mmHg (Cal.) |
| Flash point | 183.038°C (Cal.) |
| Refractive index | 1.712 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-1-Hydroxy-2(1H)-Quinolinone |