|
CAS#: 16556-48-2 Product: 1-(4-Methoxy-2,2,6,6-Tetramethyl-3-Cyclohexen-1-Yl)Ethan-1-One No suppilers available for the product. |
| Name | 1-(4-Methoxy-2,2,6,6-Tetramethyl-3-Cyclohexen-1-Yl)Ethan-1-One |
|---|---|
| Synonyms | Ethanone, 1-(4-Methoxy-2,2,6,6-Tetramethyl-3-Cyclohexen-1-Yl)-; 1-(4-Methoxy-2,2,6,6-Tetramethyl-3-Cyclohexen-1-Yl)Ethan-1-One; 4-Acetyl-1-Methoxy-3,3,5,5-Tetramethyl-1-Cyclohexene |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 |
| CAS Registry Number | 16556-48-2 |
| EINECS | 240-621-6 |
| SMILES | COC1=CC(C)(C)C(C(=O)C)C(C1)(C)C |
| InChI | 1S/C13H22O2/c1-9(14)11-12(2,3)7-10(15-6)8-13(11,4)5/h7,11H,8H2,1-6H3 |
| InChIKey | ZGMRSDALCWKJIM-UHFFFAOYSA-N |
| Density | 0.945g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.623°C at 760 mmHg (Cal.) |
| Flash point | 102.301°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Methoxy-2,2,6,6-Tetramethyl-3-Cyclohexen-1-Yl)Ethan-1-One |