Online Database of Chemicals from Around the World
|
CAS#: 16562-98-4 Product: Clantifen No suppilers available for the product. |
| Name | Clantifen |
|---|---|
| Synonyms | 4-[(2,6-Dichlorophenyl)Amino]-3-Thiophenecarboxylic Acid; 4-[(2,6-Dichlorophenyl)Amino]-3-Thenoic Acid; 3-Thiophenecarboxylic Acid, 4-((2,6-Dichlorophenyl)Amino)- |
| Molecular Structure |  |
| Molecular Formula | C11H7Cl2NO2S |
| Molecular Weight | 288.15 |
| CAS Registry Number | 16562-98-4 |
| SMILES | C1=C(C(=CS1)C(O)=O)NC2=C(C=CC=C2Cl)Cl |
| InChI | 1S/C11H7Cl2NO2S/c12-7-2-1-3-8(13)10(7)14-9-5-17-4-6(9)11(15)16/h1-5,14H,(H,15,16) |
| InChIKey | CWEUKXMDWMAICX-UHFFFAOYSA-N |
| Density | 1.589g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.106°C at 760 mmHg (Cal.) |
| Flash point | 194.568°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Clantifen |