Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 4-Fluoro-4'-(Trifluoromethyl)Benzophenone |
|---|---|
| Synonyms | 4-Fluoro-4'-(Trifluoromethyl)Benzophenone; 4-Trifluoromethylphenyl-4-Fluorophenyl Ketone |
| Molecular Structure |  |
| Molecular Formula | C14H8F4O |
| Molecular Weight | 268.21 |
| CAS Registry Number | 16574-52-0 |
| EINECS | 240-633-1 |
| SMILES | C1=C(C(F)(F)F)C=CC(=C1)C(C2=CC=C(C=C2)F)=O |
| InChI | 1S/C14H8F4O/c15-12-7-3-10(4-8-12)13(19)9-1-5-11(6-2-9)14(16,17)18/h1-8H |
| InChIKey | GYZZOEFAMMXSIK-UHFFFAOYSA-N |
| Density | 1.307g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.683°C at 760 mmHg (Cal.) |
| Flash point | 121.058°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Fluoro-4'-(Trifluoromethyl)Benzophenone |